C7H12N4O3S — CID 102693407
3-(1H-pyrazol-5-ylsulfonylamino)butanamide (PubChem CID 102693407) has the molecular formula C7H12N4O3S and a molecular weight of 232.26 g/mol. Its IUPAC name is 3-(1H-pyrazol-5-ylsulfonylamino)butanamide.
| Compound Name | 3-(1H-pyrazol-5-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 102693407 |
| Molecular Formula | C7H12N4O3S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 3-(1H-pyrazol-5-ylsulfonylamino)butanamide |
| SMILES | CC(CC(N)=O)NS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C7H12N4O3S/c1-5(4-6(8)12)11-15(13,14)7-2-3-9-10-7/h2-3,5,11H,4H2,1H3,(H2,8,12)(H,9,10) |
| InChIKey | ZYJYNHLOWLEDEV-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |