C7H11N3O5S — CID 102690640
3-hydroxy-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid (PubChem CID 102690640) has the molecular formula C7H11N3O5S and a molecular weight of 249.25 g/mol. Its IUPAC name is 3-hydroxy-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid.
| Compound Name | 3-hydroxy-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 102690640 |
| Molecular Formula | C7H11N3O5S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 3-hydroxy-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid |
| SMILES | CC(O)C(NS(=O)(=O)c1ccn[nH]1)C(=O)O |
| InChI | InChI=1S/C7H11N3O5S/c1-4(11)6(7(12)13)10-16(14,15)5-2-3-8-9-5/h2-4,6,10-11H,1H3,(H,8,9)(H,12,13) |
| InChIKey | DUAKTIXSWBFVOB-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |