C9H15N3O4S — CID 102690951
(2R)-3,3-dimethyl-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid (PubChem CID 102690951) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is (2R)-3,3-dimethyl-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid.
| Compound Name | (2R)-3,3-dimethyl-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 102690951 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (2R)-3,3-dimethyl-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid |
| SMILES | CC(C)(C)[C@@H](NS(=O)(=O)c1ccn[nH]1)C(=O)O |
| InChI | InChI=1S/C9H15N3O4S/c1-9(2,3)7(8(13)14)12-17(15,16)6-4-5-10-11-6/h4-5,7,12H,1-3H3,(H,10,11)(H,13,14)/t7-/m0/s1 |
| InChIKey | KOOJXKBVSJYHID-ZETCQYMHSA-N |
| XLogP | 0.19 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |