C13H15N3O4S — CID 102690972
4-phenyl-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid (PubChem CID 102690972) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 4-phenyl-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid.
| Compound Name | 4-phenyl-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 102690972 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-phenyl-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid |
| SMILES | O=C(O)C(CCc1ccccc1)NS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C13H15N3O4S/c17-13(18)11(7-6-10-4-2-1-3-5-10)16-21(19,20)12-8-9-14-15-12/h1-5,8-9,11,16H,6-7H2,(H,14,15)(H,17,18) |
| InChIKey | DSFJFPYBTKKQKK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |