C12H13N3O4S — CID 102692927
methyl 2-phenyl-2-(1H-pyrazol-5-ylsulfonylamino)acetate (PubChem CID 102692927) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is methyl 2-phenyl-2-(1H-pyrazol-5-ylsulfonylamino)acetate.
| Compound Name | methyl 2-phenyl-2-(1H-pyrazol-5-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 102692927 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | methyl 2-phenyl-2-(1H-pyrazol-5-ylsulfonylamino)acetate |
| SMILES | COC(=O)C(NS(=O)(=O)c1ccn[nH]1)c1ccccc1 |
| InChI | InChI=1S/C12H13N3O4S/c1-19-12(16)11(9-5-3-2-4-6-9)15-20(17,18)10-7-8-13-14-10/h2-8,11,15H,1H3,(H,13,14) |
| InChIKey | RZRYULVDTMNTLW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |