C15H10F5NO4S — CID 102431537
methyl (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-2-phenylacetate (PubChem CID 102431537) has the molecular formula C15H10F5NO4S and a molecular weight of 395.31 g/mol. Its IUPAC name is methyl (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-2-phenylacetate.
| Compound Name | methyl (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 102431537 |
| Molecular Formula | C15H10F5NO4S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | methyl (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-2-phenylacetate |
| SMILES | COC(=O)[C@@H](NS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C15H10F5NO4S/c1-25-15(22)13(7-5-3-2-4-6-7)21-26(23,24)14-11(19)9(17)8(16)10(18)12(14)20/h2-6,13,21H,1H3/t13-/m0/s1 |
| InChIKey | GVNHHIUYXXJNJM-ZDUSSCGKSA-N |
| XLogP | 2.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|