C11H14N2O6S — CID 114465514
methyl 2-(methoxycarbonylsulfamoylamino)-2-phenylacetate (PubChem CID 114465514) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is methyl 2-(methoxycarbonylsulfamoylamino)-2-phenylacetate.
| Compound Name | methyl 2-(methoxycarbonylsulfamoylamino)-2-phenylacetate |
|---|---|
| PubChem CID | 114465514 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | methyl 2-(methoxycarbonylsulfamoylamino)-2-phenylacetate |
| SMILES | COC(=O)NS(=O)(=O)NC(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O6S/c1-18-10(14)9(8-6-4-3-5-7-8)12-20(16,17)13-11(15)19-2/h3-7,9,12H,1-2H3,(H,13,15) |
| InChIKey | KVHJFUOTGAWAIA-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |