C11H16N2O5S — CID 107863586
ethyl N-[[(1R)-2-hydroxy-1-phenylethyl]sulfamoyl]carbamate (PubChem CID 107863586) has the molecular formula C11H16N2O5S and a molecular weight of 288.33 g/mol. Its IUPAC name is ethyl N-[[(1R)-2-hydroxy-1-phenylethyl]sulfamoyl]carbamate.
| Compound Name | ethyl N-[[(1R)-2-hydroxy-1-phenylethyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 107863586 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | ethyl N-[[(1R)-2-hydroxy-1-phenylethyl]sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C11H16N2O5S/c1-2-18-11(15)13-19(16,17)12-10(8-14)9-6-4-3-5-7-9/h3-7,10,12,14H,2,8H2,1H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | CIUCXFAUXCEUEZ-JTQLQIEISA-N |
| XLogP | 0.30 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |