C10H13NO5S — CID 107862097
2-[[(1S)-2-hydroxy-1-phenylethyl]sulfamoyl]acetic acid (PubChem CID 107862097) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is 2-[[(1S)-2-hydroxy-1-phenylethyl]sulfamoyl]acetic acid.
| Compound Name | 2-[[(1S)-2-hydroxy-1-phenylethyl]sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 107862097 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-[[(1S)-2-hydroxy-1-phenylethyl]sulfamoyl]acetic acid |
| SMILES | O=C(O)CS(=O)(=O)N[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C10H13NO5S/c12-6-9(8-4-2-1-3-5-8)11-17(15,16)7-10(13)14/h1-5,9,11-12H,6-7H2,(H,13,14)/t9-/m1/s1 |
| InChIKey | TYCRNPYJJGZNLZ-SECBINFHSA-N |
| XLogP | -0.28 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |