C22H24N2O6S2 — CID 101191621
1-N,3-N-bis[(1S)-2-hydroxy-1-phenylethyl]benzene-1,3-disulfonamide (PubChem CID 101191621) has the molecular formula C22H24N2O6S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 1-N,3-N-bis[(1S)-2-hydroxy-1-phenylethyl]benzene-1,3-disulfonamide.
| Compound Name | 1-N,3-N-bis[(1S)-2-hydroxy-1-phenylethyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 101191621 |
| Molecular Formula | C22H24N2O6S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 1-N,3-N-bis[(1S)-2-hydroxy-1-phenylethyl]benzene-1,3-disulfonamide |
| SMILES | O=S(=O)(N[C@H](CO)c1ccccc1)c1cccc(S(=O)(=O)N[C@H](CO)c2ccccc2)c1 |
| InChI | InChI=1S/C22H24N2O6S2/c25-15-21(17-8-3-1-4-9-17)23-31(27,28)19-12-7-13-20(14-19)32(29,30)24-22(16-26)18-10-5-2-6-11-18/h1-14,21-26H,15-16H2/t21-,22-/m1/s1 |
| InChIKey | CIROYKBATUFNHN-FGZHOGPDSA-N |
| XLogP | 1.71 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |