C17H22N2O3S — CID 71911398
3-(dimethylamino)-N-(2-hydroxy-1-phenylethyl)-4-methylbenzenesulfonamide (PubChem CID 71911398) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 3-(dimethylamino)-N-(2-hydroxy-1-phenylethyl)-4-methylbenzenesulfonamide.
| Compound Name | 3-(dimethylamino)-N-(2-hydroxy-1-phenylethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 71911398 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-(dimethylamino)-N-(2-hydroxy-1-phenylethyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CO)c2ccccc2)cc1N(C)C |
| InChI | InChI=1S/C17H22N2O3S/c1-13-9-10-15(11-17(13)19(2)3)23(21,22)18-16(12-20)14-7-5-4-6-8-14/h4-11,16,18,20H,12H2,1-3H3 |
| InChIKey | LJUOBRJHSIYMCH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |