C15H17NO4S — CID 81265322
N-(2-hydroxy-1-phenylethyl)-3-methoxybenzenesulfonamide (PubChem CID 81265322) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is N-(2-hydroxy-1-phenylethyl)-3-methoxybenzenesulfonamide.
| Compound Name | N-(2-hydroxy-1-phenylethyl)-3-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 81265322 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-(2-hydroxy-1-phenylethyl)-3-methoxybenzenesulfonamide |
| SMILES | COc1cccc(S(=O)(=O)NC(CO)c2ccccc2)c1 |
| InChI | InChI=1S/C15H17NO4S/c1-20-13-8-5-9-14(10-13)21(18,19)16-15(11-17)12-6-3-2-4-7-12/h2-10,15-17H,11H2,1H3 |
| InChIKey | MSNDQSPQJYBTRH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |