C10H13NO6S — CID 69117008
(2R)-3-hydroxy-2-[(3-methoxyphenyl)sulfonylamino]propanoic acid (PubChem CID 69117008) has the molecular formula C10H13NO6S and a molecular weight of 275.28 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[(3-methoxyphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[(3-methoxyphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 69117008 |
| Molecular Formula | C10H13NO6S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | (2R)-3-hydroxy-2-[(3-methoxyphenyl)sulfonylamino]propanoic acid |
| SMILES | COc1cccc(S(=O)(=O)N[C@H](CO)C(=O)O)c1 |
| InChI | InChI=1S/C10H13NO6S/c1-17-7-3-2-4-8(5-7)18(15,16)11-9(6-12)10(13)14/h2-5,9,11-12H,6H2,1H3,(H,13,14)/t9-/m1/s1 |
| InChIKey | YGRDISGVJWXWAX-SECBINFHSA-N |
| XLogP | -0.58 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |