C13H16N2O3S — CID 63182937
N-(2-hydroxy-1-phenylethyl)-1-methylpyrrole-3-sulfonamide (PubChem CID 63182937) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is N-(2-hydroxy-1-phenylethyl)-1-methylpyrrole-3-sulfonamide.
| Compound Name | N-(2-hydroxy-1-phenylethyl)-1-methylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 63182937 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | N-(2-hydroxy-1-phenylethyl)-1-methylpyrrole-3-sulfonamide |
| SMILES | Cn1ccc(S(=O)(=O)NC(CO)c2ccccc2)c1 |
| InChI | InChI=1S/C13H16N2O3S/c1-15-8-7-12(9-15)19(17,18)14-13(10-16)11-5-3-2-4-6-11/h2-9,13-14,16H,10H2,1H3 |
| InChIKey | KLVFYVSMGMGRAT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |