C13H15NO7S — CID 102356889
methyl 2-[methoxycarbonylsulfamoyloxy(phenyl)methyl]prop-2-enoate (PubChem CID 102356889) has the molecular formula C13H15NO7S and a molecular weight of 329.33 g/mol. Its IUPAC name is methyl 2-[methoxycarbonylsulfamoyloxy(phenyl)methyl]prop-2-enoate.
| Compound Name | methyl 2-[methoxycarbonylsulfamoyloxy(phenyl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 102356889 |
| Molecular Formula | C13H15NO7S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | methyl 2-[methoxycarbonylsulfamoyloxy(phenyl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(OS(=O)(=O)NC(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C13H15NO7S/c1-9(12(15)19-2)11(10-7-5-4-6-8-10)21-22(17,18)14-13(16)20-3/h4-8,11H,1H2,2-3H3,(H,14,16) |
| InChIKey | RRLMYCHDJIHVFI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|