C13H12BrNO4S2 — CID 3675533
methyl 2-[(5-bromothiophen-2-yl)sulfonylamino]-2-phenylacetate (PubChem CID 3675533) has the molecular formula C13H12BrNO4S2 and a molecular weight of 390.28 g/mol. Its IUPAC name is methyl 2-[(5-bromothiophen-2-yl)sulfonylamino]-2-phenylacetate.
| Compound Name | methyl 2-[(5-bromothiophen-2-yl)sulfonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 3675533 |
| Molecular Formula | C13H12BrNO4S2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 388.94 |
| IUPAC Name | methyl 2-[(5-bromothiophen-2-yl)sulfonylamino]-2-phenylacetate |
| SMILES | COC(=O)C(NS(=O)(=O)c1ccc(Br)s1)c1ccccc1 |
| InChI | InChI=1S/C13H12BrNO4S2/c1-19-13(16)12(9-5-3-2-4-6-9)15-21(17,18)11-8-7-10(14)20-11/h2-8,12,15H,1H3 |
| InChIKey | ZBWLYCLNBYOMBC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |