C16H15BrN2O4S2 — CID 135020887
methyl (2R)-2-[(5-bromothiophen-2-yl)sulfonylamino]-3-(1H-indol-2-yl)propanoate (PubChem CID 135020887) has the molecular formula C16H15BrN2O4S2 and a molecular weight of 443.34 g/mol. Its IUPAC name is methyl (2R)-2-[(5-bromothiophen-2-yl)sulfonylamino]-3-(1H-indol-2-yl)propanoate.
| Compound Name | methyl (2R)-2-[(5-bromothiophen-2-yl)sulfonylamino]-3-(1H-indol-2-yl)propanoate |
|---|---|
| PubChem CID | 135020887 |
| Molecular Formula | C16H15BrN2O4S2 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | methyl (2R)-2-[(5-bromothiophen-2-yl)sulfonylamino]-3-(1H-indol-2-yl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1cc2ccccc2[nH]1)NS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C16H15BrN2O4S2/c1-23-16(20)13(19-25(21,22)15-7-6-14(17)24-15)9-11-8-10-4-2-3-5-12(10)18-11/h2-8,13,18-19H,9H2,1H3/t13-/m1/s1 |
| InChIKey | CWEAFZJZRORYKA-CYBMUJFWSA-N |
| XLogP | 3.05 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |