C14H12F2N2O3S — CID 94579625
(2R)-2-[(2,6-difluorophenyl)sulfonylamino]-2-phenylacetamide (PubChem CID 94579625) has the molecular formula C14H12F2N2O3S and a molecular weight of 326.32 g/mol. Its IUPAC name is (2R)-2-[(2,6-difluorophenyl)sulfonylamino]-2-phenylacetamide.
| Compound Name | (2R)-2-[(2,6-difluorophenyl)sulfonylamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 94579625 |
| Molecular Formula | C14H12F2N2O3S |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (2R)-2-[(2,6-difluorophenyl)sulfonylamino]-2-phenylacetamide |
| SMILES | NC(=O)[C@H](NS(=O)(=O)c1c(F)cccc1F)c1ccccc1 |
| InChI | InChI=1S/C14H12F2N2O3S/c15-10-7-4-8-11(16)13(10)22(20,21)18-12(14(17)19)9-5-2-1-3-6-9/h1-8,12,18H,(H2,17,19)/t12-/m1/s1 |
| InChIKey | UTOMRQHCZOZCCG-GFCCVEGCSA-N |
| XLogP | 1.47 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |