C13H15N3O4S — CID 75459963
2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-2-phenylacetamide (PubChem CID 75459963) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-2-phenylacetamide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 75459963 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-2-phenylacetamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NC(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C13H15N3O4S/c1-8-12(9(2)20-15-8)21(18,19)16-11(13(14)17)10-6-4-3-5-7-10/h3-7,11,16H,1-2H3,(H2,14,17) |
| InChIKey | QTXKGCJNMKPGAS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |