C7H7F2N3O3S — CID 140574542
[(2,6-difluorophenyl)sulfonylamino]urea (PubChem CID 140574542) has the molecular formula C7H7F2N3O3S and a molecular weight of 251.21 g/mol. Its IUPAC name is [(2,6-difluorophenyl)sulfonylamino]urea.
| Compound Name | [(2,6-difluorophenyl)sulfonylamino]urea |
|---|---|
| PubChem CID | 140574542 |
| Molecular Formula | C7H7F2N3O3S |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | [(2,6-difluorophenyl)sulfonylamino]urea |
| SMILES | NC(=O)NNS(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C7H7F2N3O3S/c8-4-2-1-3-5(9)6(4)16(14,15)12-11-7(10)13/h1-3,12H,(H3,10,11,13) |
| InChIKey | CEBJSXXZNIXAHT-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|