C8H10F2N2O2S — CID 43603529
N-(2-aminoethyl)-2,6-difluorobenzenesulfonamide (PubChem CID 43603529) has the molecular formula C8H10F2N2O2S and a molecular weight of 236.24 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,6-difluorobenzenesulfonamide.
| Compound Name | N-(2-aminoethyl)-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 43603529 |
| Molecular Formula | C8H10F2N2O2S |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | N-(2-aminoethyl)-2,6-difluorobenzenesulfonamide |
| SMILES | NCCNS(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C8H10F2N2O2S/c9-6-2-1-3-7(10)8(6)15(13,14)12-5-4-11/h1-3,12H,4-5,11H2 |
| InChIKey | YTRCKOHWQHDLPW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |