C8H11ClF2N2O2S — CID 119960023
N-(2-aminoethyl)-2,3-difluorobenzenesulfonamide;hydrochloride (PubChem CID 119960023) has the molecular formula C8H11ClF2N2O2S and a molecular weight of 272.70 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,3-difluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2,3-difluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119960023 |
| Molecular Formula | C8H11ClF2N2O2S |
| Molecular Weight | 272.70 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | N-(2-aminoethyl)-2,3-difluorobenzenesulfonamide;hydrochloride |
| SMILES | Cl.NCCNS(=O)(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C8H10F2N2O2S.ClH/c9-6-2-1-3-7(8(6)10)15(13,14)12-5-4-11;/h1-3,12H,4-5,11H2;1H |
| InChIKey | MRBVEEJBCVCGFS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.70 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |