C9H14ClFN2O2S — CID 86814122
N-(2-aminoethyl)-2-fluoro-4-methylbenzenesulfonamide;hydrochloride (PubChem CID 86814122) has the molecular formula C9H14ClFN2O2S and a molecular weight of 268.74 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-fluoro-4-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-fluoro-4-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 86814122 |
| Molecular Formula | C9H14ClFN2O2S |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | N-(2-aminoethyl)-2-fluoro-4-methylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)NCCN)c(F)c1.Cl |
| InChI | InChI=1S/C9H13FN2O2S.ClH/c1-7-2-3-9(8(10)6-7)15(13,14)12-5-4-11;/h2-3,6,12H,4-5,11H2,1H3;1H |
| InChIKey | YGUVPCUUFIZYGW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |