C8H11Cl2FN2O2S — CID 86780565
N-(2-aminoethyl)-2-chloro-5-fluorobenzenesulfonamide;hydrochloride (PubChem CID 86780565) has the molecular formula C8H11Cl2FN2O2S and a molecular weight of 289.16 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-chloro-5-fluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-chloro-5-fluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 86780565 |
| Molecular Formula | C8H11Cl2FN2O2S |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | N-(2-aminoethyl)-2-chloro-5-fluorobenzenesulfonamide;hydrochloride |
| SMILES | Cl.NCCNS(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C8H10ClFN2O2S.ClH/c9-7-2-1-6(10)5-8(7)15(13,14)12-4-3-11;/h1-2,5,12H,3-4,11H2;1H |
| InChIKey | KWNOISLRZZGOMP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |