C12H17ClFN3O2S — CID 115752213
2-chloro-5-fluoro-N-(2-piperazin-1-ylethyl)benzenesulfonamide (PubChem CID 115752213) has the molecular formula C12H17ClFN3O2S and a molecular weight of 321.81 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-(2-piperazin-1-ylethyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-fluoro-N-(2-piperazin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115752213 |
| Molecular Formula | C12H17ClFN3O2S |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-chloro-5-fluoro-N-(2-piperazin-1-ylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCN1CCNCC1)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C12H17ClFN3O2S/c13-11-2-1-10(14)9-12(11)20(18,19)16-5-8-17-6-3-15-4-7-17/h1-2,9,15-16H,3-8H2 |
| InChIKey | SWGMFSDBHMIPRT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |