C8H9ClFN3O3S — CID 105400574
2-[(2-chloro-5-fluorophenyl)sulfonylamino]-N'-hydroxyethanimidamide (PubChem CID 105400574) has the molecular formula C8H9ClFN3O3S and a molecular weight of 281.70 g/mol. Its IUPAC name is 2-[(2-chloro-5-fluorophenyl)sulfonylamino]-N'-hydroxyethanimidamide.
| Compound Name | 2-[(2-chloro-5-fluorophenyl)sulfonylamino]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 105400574 |
| Molecular Formula | C8H9ClFN3O3S |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 2-[(2-chloro-5-fluorophenyl)sulfonylamino]-N'-hydroxyethanimidamide |
| SMILES | N/C(CNS(=O)(=O)c1cc(F)ccc1Cl)=N/O |
| InChI | InChI=1S/C8H9ClFN3O3S/c9-6-2-1-5(10)3-7(6)17(15,16)12-4-8(11)13-14/h1-3,12,14H,4H2,(H2,11,13) |
| InChIKey | CKAUQTZWLGXGCB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|