C12H17ClFNO3S — CID 115701461
2-chloro-N-(2-ethyl-4-hydroxybutyl)-5-fluorobenzenesulfonamide (PubChem CID 115701461) has the molecular formula C12H17ClFNO3S and a molecular weight of 309.79 g/mol. Its IUPAC name is 2-chloro-N-(2-ethyl-4-hydroxybutyl)-5-fluorobenzenesulfonamide.
| Compound Name | 2-chloro-N-(2-ethyl-4-hydroxybutyl)-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 115701461 |
| Molecular Formula | C12H17ClFNO3S |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-chloro-N-(2-ethyl-4-hydroxybutyl)-5-fluorobenzenesulfonamide |
| SMILES | CCC(CCO)CNS(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C12H17ClFNO3S/c1-2-9(5-6-16)8-15-19(17,18)12-7-10(14)3-4-11(12)13/h3-4,7,9,15-16H,2,5-6,8H2,1H3 |
| InChIKey | KCLBACAOPJSJCN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |