C13H19ClFNO3S — CID 109478315
1-(3-chloro-4-fluorophenyl)-N-(2-ethyl-4-hydroxybutyl)methanesulfonamide (PubChem CID 109478315) has the molecular formula C13H19ClFNO3S and a molecular weight of 323.82 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-(2-ethyl-4-hydroxybutyl)methanesulfonamide.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-(2-ethyl-4-hydroxybutyl)methanesulfonamide |
|---|---|
| PubChem CID | 109478315 |
| Molecular Formula | C13H19ClFNO3S |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-(2-ethyl-4-hydroxybutyl)methanesulfonamide |
| SMILES | CCC(CCO)CNS(=O)(=O)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H19ClFNO3S/c1-2-10(5-6-17)8-16-20(18,19)9-11-3-4-13(15)12(14)7-11/h3-4,7,10,16-17H,2,5-6,8-9H2,1H3 |
| InChIKey | JAOCMIPUWMOVJT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |