C13H13ClFNO4S — CID 97078736
1-(3-chloro-4-fluorophenyl)-N-[(1R)-1-(furan-2-yl)-2-hydroxyethyl]methanesulfonamide (PubChem CID 97078736) has the molecular formula C13H13ClFNO4S and a molecular weight of 333.77 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-[(1R)-1-(furan-2-yl)-2-hydroxyethyl]methanesulfonamide.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-[(1R)-1-(furan-2-yl)-2-hydroxyethyl]methanesulfonamide |
|---|---|
| PubChem CID | 97078736 |
| Molecular Formula | C13H13ClFNO4S |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-[(1R)-1-(furan-2-yl)-2-hydroxyethyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)c(Cl)c1)N[C@H](CO)c1ccco1 |
| InChI | InChI=1S/C13H13ClFNO4S/c14-10-6-9(3-4-11(10)15)8-21(18,19)16-12(7-17)13-2-1-5-20-13/h1-6,12,16-17H,7-8H2/t12-/m1/s1 |
| InChIKey | ZRYIGMCTQZNNOZ-GFCCVEGCSA-N |
| XLogP | 2.23 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |