C19H16ClFN2O2S — CID 97014874
1-(3-chloro-4-fluorophenyl)-N-[(S)-phenyl(pyridin-2-yl)methyl]methanesulfonamide (PubChem CID 97014874) has the molecular formula C19H16ClFN2O2S and a molecular weight of 390.87 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-[(S)-phenyl(pyridin-2-yl)methyl]methanesulfonamide.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-[(S)-phenyl(pyridin-2-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 97014874 |
| Molecular Formula | C19H16ClFN2O2S |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-[(S)-phenyl(pyridin-2-yl)methyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)c(Cl)c1)N[C@@H](c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C19H16ClFN2O2S/c20-16-12-14(9-10-17(16)21)13-26(24,25)23-19(15-6-2-1-3-7-15)18-8-4-5-11-22-18/h1-12,19,23H,13H2/t19-/m0/s1 |
| InChIKey | PMSBSQODFQTEHI-IBGZPJMESA-N |
| XLogP | 4.08 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |