C19H16Cl2N2O2S — CID 56581941
1-(3,4-dichlorophenyl)-N-[phenyl(pyridin-2-yl)methyl]methanesulfonamide (PubChem CID 56581941) has the molecular formula C19H16Cl2N2O2S and a molecular weight of 407.32 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-[phenyl(pyridin-2-yl)methyl]methanesulfonamide.
| Compound Name | 1-(3,4-dichlorophenyl)-N-[phenyl(pyridin-2-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 56581941 |
| Molecular Formula | C19H16Cl2N2O2S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-[phenyl(pyridin-2-yl)methyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(Cl)c(Cl)c1)NC(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C19H16Cl2N2O2S/c20-16-10-9-14(12-17(16)21)13-26(24,25)23-19(15-6-2-1-3-7-15)18-8-4-5-11-22-18/h1-12,19,23H,13H2 |
| InChIKey | FGDBVOOWURDGBD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |