C15H14BrCl2NO2S — CID 56513401
N-[1-(3-bromophenyl)ethyl]-1-(3,4-dichlorophenyl)methanesulfonamide (PubChem CID 56513401) has the molecular formula C15H14BrCl2NO2S and a molecular weight of 423.16 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)ethyl]-1-(3,4-dichlorophenyl)methanesulfonamide.
| Compound Name | N-[1-(3-bromophenyl)ethyl]-1-(3,4-dichlorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 56513401 |
| Molecular Formula | C15H14BrCl2NO2S |
| Molecular Weight | 423.16 g/mol |
| Exact Mass | 420.93 |
| IUPAC Name | N-[1-(3-bromophenyl)ethyl]-1-(3,4-dichlorophenyl)methanesulfonamide |
| SMILES | CC(NS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H14BrCl2NO2S/c1-10(12-3-2-4-13(16)8-12)19-22(20,21)9-11-5-6-14(17)15(18)7-11/h2-8,10,19H,9H2,1H3 |
| InChIKey | ZVIVWTQSEMWJCT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.16 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |