C13H19BrN2O2S — CID 106002819
N-[1-(3-bromophenyl)ethyl]-2-(cyclopropylamino)ethanesulfonamide (PubChem CID 106002819) has the molecular formula C13H19BrN2O2S and a molecular weight of 347.28 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)ethyl]-2-(cyclopropylamino)ethanesulfonamide.
| Compound Name | N-[1-(3-bromophenyl)ethyl]-2-(cyclopropylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 106002819 |
| Molecular Formula | C13H19BrN2O2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | N-[1-(3-bromophenyl)ethyl]-2-(cyclopropylamino)ethanesulfonamide |
| SMILES | CC(NS(=O)(=O)CCNC1CC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H19BrN2O2S/c1-10(11-3-2-4-12(14)9-11)16-19(17,18)8-7-15-13-5-6-13/h2-4,9-10,13,15-16H,5-8H2,1H3 |
| InChIKey | QQRHHSWKRCWTPE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |