C12H17BrN2O2S — CID 106061607
N-(3-bromophenyl)-3-(cyclopropylamino)propane-1-sulfonamide (PubChem CID 106061607) has the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. Its IUPAC name is N-(3-bromophenyl)-3-(cyclopropylamino)propane-1-sulfonamide.
| Compound Name | N-(3-bromophenyl)-3-(cyclopropylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 106061607 |
| Molecular Formula | C12H17BrN2O2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | N-(3-bromophenyl)-3-(cyclopropylamino)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCNC1CC1)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C12H17BrN2O2S/c13-10-3-1-4-12(9-10)15-18(16,17)8-2-7-14-11-5-6-11/h1,3-4,9,11,14-15H,2,5-8H2 |
| InChIKey | WEKUNYAPLOQLLP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|