C12H16BrNO4S — CID 81371590
4-[[(1R)-1-(3-bromophenyl)ethyl]sulfamoyl]butanoic acid (PubChem CID 81371590) has the molecular formula C12H16BrNO4S and a molecular weight of 350.23 g/mol. Its IUPAC name is 4-[[(1R)-1-(3-bromophenyl)ethyl]sulfamoyl]butanoic acid.
| Compound Name | 4-[[(1R)-1-(3-bromophenyl)ethyl]sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 81371590 |
| Molecular Formula | C12H16BrNO4S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 4-[[(1R)-1-(3-bromophenyl)ethyl]sulfamoyl]butanoic acid |
| SMILES | C[C@@H](NS(=O)(=O)CCCC(=O)O)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H16BrNO4S/c1-9(10-4-2-5-11(13)8-10)14-19(17,18)7-3-6-12(15)16/h2,4-5,8-9,14H,3,6-7H2,1H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | JSESFXKWHZNTHW-SECBINFHSA-N |
| XLogP | 2.29 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |