C10H13F2NO2S — CID 167068212
N-tert-butyl-2,3-difluorobenzenesulfonamide (PubChem CID 167068212) has the molecular formula C10H13F2NO2S and a molecular weight of 249.28 g/mol. Its IUPAC name is N-tert-butyl-2,3-difluorobenzenesulfonamide.
| Compound Name | N-tert-butyl-2,3-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 167068212 |
| Molecular Formula | C10H13F2NO2S |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | N-tert-butyl-2,3-difluorobenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C10H13F2NO2S/c1-10(2,3)13-16(14,15)8-6-4-5-7(11)9(8)12/h4-6,13H,1-3H3 |
| InChIKey | AWFYFYUDCBROOE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |