C14H12ClF2NO2S2 — CID 8801394
N-[2-(4-chlorophenyl)sulfanylethyl]-2,6-difluorobenzenesulfonamide (PubChem CID 8801394) has the molecular formula C14H12ClF2NO2S2 and a molecular weight of 363.84 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 8801394 |
| Molecular Formula | C14H12ClF2NO2S2 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2,6-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCSc1ccc(Cl)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C14H12ClF2NO2S2/c15-10-4-6-11(7-5-10)21-9-8-18-22(19,20)14-12(16)2-1-3-13(14)17/h1-7,18H,8-9H2 |
| InChIKey | JXKFXTKLIPOFFY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|