C17H16ClFN2O3S2 — CID 55903441
N-[2-(4-chlorophenyl)sulfanylethyl]-7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide (PubChem CID 55903441) has the molecular formula C17H16ClFN2O3S2 and a molecular weight of 414.91 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 55903441 |
| Molecular Formula | C17H16ClFN2O3S2 |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
| SMILES | O=C1CCc2cc(S(=O)(=O)NCCSc3ccc(Cl)cc3)c(F)cc2N1 |
| InChI | InChI=1S/C17H16ClFN2O3S2/c18-12-2-4-13(5-3-12)25-8-7-20-26(23,24)16-9-11-1-6-17(22)21-15(11)10-14(16)19/h2-5,9-10,20H,1,6-8H2,(H,21,22) |
| InChIKey | HYJJDORMOMOKGD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|