C14H12ClF2NO3S2 — CID 10339700
4-chloro-N-[2-(3,5-difluoro-4-hydroxyphenyl)sulfanylethyl]benzenesulfonamide (PubChem CID 10339700) has the molecular formula C14H12ClF2NO3S2 and a molecular weight of 379.84 g/mol. Its IUPAC name is 4-chloro-N-[2-(3,5-difluoro-4-hydroxyphenyl)sulfanylethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-(3,5-difluoro-4-hydroxyphenyl)sulfanylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10339700 |
| Molecular Formula | C14H12ClF2NO3S2 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 4-chloro-N-[2-(3,5-difluoro-4-hydroxyphenyl)sulfanylethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCSc1cc(F)c(O)c(F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12ClF2NO3S2/c15-9-1-3-11(4-2-9)23(20,21)18-5-6-22-10-7-12(16)14(19)13(17)8-10/h1-4,7-8,18-19H,5-6H2 |
| InChIKey | JXILBDQZKSQAOP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|