C17H16ClF2NO5S2 — CID 11744556
2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfanyl]-2,6-difluorophenoxy]propanoic acid (PubChem CID 11744556) has the molecular formula C17H16ClF2NO5S2 and a molecular weight of 451.90 g/mol. Its IUPAC name is 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfanyl]-2,6-difluorophenoxy]propanoic acid.
| Compound Name | 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfanyl]-2,6-difluorophenoxy]propanoic acid |
|---|---|
| PubChem CID | 11744556 |
| Molecular Formula | C17H16ClF2NO5S2 |
| Molecular Weight | 451.90 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfanyl]-2,6-difluorophenoxy]propanoic acid |
| SMILES | CC(Oc1c(F)cc(SCCNS(=O)(=O)c2ccc(Cl)cc2)cc1F)C(=O)O |
| InChI | InChI=1S/C17H16ClF2NO5S2/c1-10(17(22)23)26-16-14(19)8-12(9-15(16)20)27-7-6-21-28(24,25)13-4-2-11(18)3-5-13/h2-5,8-10,21H,6-7H2,1H3,(H,22,23) |
| InChIKey | CXIBSNHQNNJPNR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.90 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|