C18H20F2N2O4S2 — CID 175016364
N-[4-[2-(benzenesulfonamido)ethylsulfanyl]-2,6-difluorophenoxy]-2-methylpropanamide (PubChem CID 175016364) has the molecular formula C18H20F2N2O4S2 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[4-[2-(benzenesulfonamido)ethylsulfanyl]-2,6-difluorophenoxy]-2-methylpropanamide.
| Compound Name | N-[4-[2-(benzenesulfonamido)ethylsulfanyl]-2,6-difluorophenoxy]-2-methylpropanamide |
|---|---|
| PubChem CID | 175016364 |
| Molecular Formula | C18H20F2N2O4S2 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | N-[4-[2-(benzenesulfonamido)ethylsulfanyl]-2,6-difluorophenoxy]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NOc1c(F)cc(SCCNS(=O)(=O)c2ccccc2)cc1F |
| InChI | InChI=1S/C18H20F2N2O4S2/c1-12(2)18(23)22-26-17-15(19)10-13(11-16(17)20)27-9-8-21-28(24,25)14-6-4-3-5-7-14/h3-7,10-12,21H,8-9H2,1-2H3,(H,22,23) |
| InChIKey | CTJVSHHIHWSCHB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|