C16H16F2N2O2S2 — CID 145228359
2-[2,6-difluoro-4-[2-(phenylsulfanylamino)ethylsulfanyl]phenoxy]acetamide (PubChem CID 145228359) has the molecular formula C16H16F2N2O2S2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[2-(phenylsulfanylamino)ethylsulfanyl]phenoxy]acetamide.
| Compound Name | 2-[2,6-difluoro-4-[2-(phenylsulfanylamino)ethylsulfanyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 145228359 |
| Molecular Formula | C16H16F2N2O2S2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2-[2,6-difluoro-4-[2-(phenylsulfanylamino)ethylsulfanyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1c(F)cc(SCCNSc2ccccc2)cc1F |
| InChI | InChI=1S/C16H16F2N2O2S2/c17-13-8-12(9-14(18)16(13)22-10-15(19)21)23-7-6-20-24-11-4-2-1-3-5-11/h1-5,8-9,20H,6-7,10H2,(H2,19,21) |
| InChIKey | OMJVNSDUUZGAAM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|