C17H18F2N2O3S3 — CID 155217672
2-[4-[2-[benzenesulfinyl(methylsulfanyl)amino]ethylsulfanyl]-2,6-difluorophenoxy]acetamide (PubChem CID 155217672) has the molecular formula C17H18F2N2O3S3 and a molecular weight of 432.54 g/mol. Its IUPAC name is 2-[4-[2-[benzenesulfinyl(methylsulfanyl)amino]ethylsulfanyl]-2,6-difluorophenoxy]acetamide.
| Compound Name | 2-[4-[2-[benzenesulfinyl(methylsulfanyl)amino]ethylsulfanyl]-2,6-difluorophenoxy]acetamide |
|---|---|
| PubChem CID | 155217672 |
| Molecular Formula | C17H18F2N2O3S3 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 2-[4-[2-[benzenesulfinyl(methylsulfanyl)amino]ethylsulfanyl]-2,6-difluorophenoxy]acetamide |
| SMILES | CSN(CCSc1cc(F)c(OCC(N)=O)c(F)c1)S(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18F2N2O3S3/c1-25-21(27(23)13-5-3-2-4-6-13)7-8-26-12-9-14(18)17(15(19)10-12)24-11-16(20)22/h2-6,9-10H,7-8,11H2,1H3,(H2,20,22) |
| InChIKey | JIXTXKJZFGTCDJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|