C12H16F2N2O3 — CID 79891535
2-[2,6-difluoro-4-[(2-methoxyethylamino)methyl]phenoxy]acetamide (PubChem CID 79891535) has the molecular formula C12H16F2N2O3 and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[(2-methoxyethylamino)methyl]phenoxy]acetamide.
| Compound Name | 2-[2,6-difluoro-4-[(2-methoxyethylamino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 79891535 |
| Molecular Formula | C12H16F2N2O3 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-[2,6-difluoro-4-[(2-methoxyethylamino)methyl]phenoxy]acetamide |
| SMILES | COCCNCc1cc(F)c(OCC(N)=O)c(F)c1 |
| InChI | InChI=1S/C12H16F2N2O3/c1-18-3-2-16-6-8-4-9(13)12(10(14)5-8)19-7-11(15)17/h4-5,16H,2-3,6-7H2,1H3,(H2,15,17) |
| InChIKey | OYWNQPJKMALGQS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|