C14H21F2NO4 — CID 79884097
1-[2,6-difluoro-4-[(2-methoxyethylamino)methyl]phenoxy]-3-methoxypropan-2-ol (PubChem CID 79884097) has the molecular formula C14H21F2NO4 and a molecular weight of 305.32 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-[(2-methoxyethylamino)methyl]phenoxy]-3-methoxypropan-2-ol.
| Compound Name | 1-[2,6-difluoro-4-[(2-methoxyethylamino)methyl]phenoxy]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 79884097 |
| Molecular Formula | C14H21F2NO4 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-[2,6-difluoro-4-[(2-methoxyethylamino)methyl]phenoxy]-3-methoxypropan-2-ol |
| SMILES | COCCNCc1cc(F)c(OCC(O)COC)c(F)c1 |
| InChI | InChI=1S/C14H21F2NO4/c1-19-4-3-17-7-10-5-12(15)14(13(16)6-10)21-9-11(18)8-20-2/h5-6,11,17-18H,3-4,7-9H2,1-2H3 |
| InChIKey | IDGVQJYDSZQIKI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|