C16H26F2N2O — CID 63060197
N-ethyl-2,6-difluoro-4-[(2-methoxyethylamino)methyl]-N-(2-methylpropyl)aniline (PubChem CID 63060197) has the molecular formula C16H26F2N2O and a molecular weight of 300.39 g/mol. Its IUPAC name is N-ethyl-2,6-difluoro-4-[(2-methoxyethylamino)methyl]-N-(2-methylpropyl)aniline.
| Compound Name | N-ethyl-2,6-difluoro-4-[(2-methoxyethylamino)methyl]-N-(2-methylpropyl)aniline |
|---|---|
| PubChem CID | 63060197 |
| Molecular Formula | C16H26F2N2O |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-ethyl-2,6-difluoro-4-[(2-methoxyethylamino)methyl]-N-(2-methylpropyl)aniline |
| SMILES | CCN(CC(C)C)c1c(F)cc(CNCCOC)cc1F |
| InChI | InChI=1S/C16H26F2N2O/c1-5-20(11-12(2)3)16-14(17)8-13(9-15(16)18)10-19-6-7-21-4/h8-9,12,19H,5-7,10-11H2,1-4H3 |
| InChIKey | CEUQCCSIDMKENM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|