C15H23F2NOS — CID 107761884
N-[[3,5-difluoro-4-(3-methylbutylsulfanyl)phenyl]methyl]-2-methoxyethanamine (PubChem CID 107761884) has the molecular formula C15H23F2NOS and a molecular weight of 303.42 g/mol. Its IUPAC name is N-[[3,5-difluoro-4-(3-methylbutylsulfanyl)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3,5-difluoro-4-(3-methylbutylsulfanyl)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 107761884 |
| Molecular Formula | C15H23F2NOS |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-[[3,5-difluoro-4-(3-methylbutylsulfanyl)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(F)c(SCCC(C)C)c(F)c1 |
| InChI | InChI=1S/C15H23F2NOS/c1-11(2)4-7-20-15-13(16)8-12(9-14(15)17)10-18-5-6-19-3/h8-9,11,18H,4-7,10H2,1-3H3 |
| InChIKey | UVMZRNQWJNAGCU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|