C16H23F2NOS — CID 63814251
N-[[4-(cyclopentylmethylsulfanyl)-3,5-difluorophenyl]methyl]-2-methoxyethanamine (PubChem CID 63814251) has the molecular formula C16H23F2NOS and a molecular weight of 315.43 g/mol. Its IUPAC name is N-[[4-(cyclopentylmethylsulfanyl)-3,5-difluorophenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[4-(cyclopentylmethylsulfanyl)-3,5-difluorophenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63814251 |
| Molecular Formula | C16H23F2NOS |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-[[4-(cyclopentylmethylsulfanyl)-3,5-difluorophenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(F)c(SCC2CCCC2)c(F)c1 |
| InChI | InChI=1S/C16H23F2NOS/c1-20-7-6-19-10-13-8-14(17)16(15(18)9-13)21-11-12-4-2-3-5-12/h8-9,12,19H,2-7,10-11H2,1H3 |
| InChIKey | ANWWKFGXKIUDIA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|