C16H24ClNOS — CID 81160113
N-[[3-chloro-4-(cyclopentylmethylsulfanyl)phenyl]methyl]-2-methoxyethanamine (PubChem CID 81160113) has the molecular formula C16H24ClNOS and a molecular weight of 313.89 g/mol. Its IUPAC name is N-[[3-chloro-4-(cyclopentylmethylsulfanyl)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-chloro-4-(cyclopentylmethylsulfanyl)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 81160113 |
| Molecular Formula | C16H24ClNOS |
| Molecular Weight | 313.89 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[[3-chloro-4-(cyclopentylmethylsulfanyl)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccc(SCC2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C16H24ClNOS/c1-19-9-8-18-11-14-6-7-16(15(17)10-14)20-12-13-4-2-3-5-13/h6-7,10,13,18H,2-5,8-9,11-12H2,1H3 |
| InChIKey | WPZRISPAQGXZOE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.89 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|