C16H17Cl2NOS — CID 81160781
N-[[3-chloro-4-(3-chlorophenyl)sulfanylphenyl]methyl]-2-methoxyethanamine (PubChem CID 81160781) has the molecular formula C16H17Cl2NOS and a molecular weight of 342.29 g/mol. Its IUPAC name is N-[[3-chloro-4-(3-chlorophenyl)sulfanylphenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-chloro-4-(3-chlorophenyl)sulfanylphenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 81160781 |
| Molecular Formula | C16H17Cl2NOS |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-[[3-chloro-4-(3-chlorophenyl)sulfanylphenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccc(Sc2cccc(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2NOS/c1-20-8-7-19-11-12-5-6-16(15(18)9-12)21-14-4-2-3-13(17)10-14/h2-6,9-10,19H,7-8,11H2,1H3 |
| InChIKey | ALMKAPQKYKADCC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|